C14H15ClO — CID 61082154
3-[chloro-(3,4-dimethylphenyl)methyl]-2-methylfuran (PubChem CID 61082154) has the molecular formula C14H15ClO and a molecular weight of 234.73 g/mol. Its IUPAC name is 3-[chloro-(3,4-dimethylphenyl)methyl]-2-methylfuran.
| Compound Name | 3-[chloro-(3,4-dimethylphenyl)methyl]-2-methylfuran |
|---|---|
| PubChem CID | 61082154 |
| Molecular Formula | C14H15ClO |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 3-[chloro-(3,4-dimethylphenyl)methyl]-2-methylfuran |
| SMILES | Cc1ccc(C(Cl)c2ccoc2C)cc1C |
| InChI | InChI=1S/C14H15ClO/c1-9-4-5-12(8-10(9)2)14(15)13-6-7-16-11(13)3/h4-8,14H,1-3H3 |
| InChIKey | PBRFNXJNGJQBEM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|