C12H8ClF3O — CID 103303625
3-[chloro-(2,4,5-trifluorophenyl)methyl]-2-methylfuran (PubChem CID 103303625) has the molecular formula C12H8ClF3O and a molecular weight of 260.64 g/mol. Its IUPAC name is 3-[chloro-(2,4,5-trifluorophenyl)methyl]-2-methylfuran.
| Compound Name | 3-[chloro-(2,4,5-trifluorophenyl)methyl]-2-methylfuran |
|---|---|
| PubChem CID | 103303625 |
| Molecular Formula | C12H8ClF3O |
| Molecular Weight | 260.64 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 3-[chloro-(2,4,5-trifluorophenyl)methyl]-2-methylfuran |
| SMILES | Cc1occc1C(Cl)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H8ClF3O/c1-6-7(2-3-17-6)12(13)8-4-10(15)11(16)5-9(8)14/h2-5,12H,1H3 |
| InChIKey | JFXQQSDBBIDIPG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|