C13H5ClF6 — CID 103303785
1-[chloro-(2,3,4-trifluorophenyl)methyl]-2,4,5-trifluorobenzene (PubChem CID 103303785) has the molecular formula C13H5ClF6 and a molecular weight of 310.62 g/mol. Its IUPAC name is 1-[chloro-(2,3,4-trifluorophenyl)methyl]-2,4,5-trifluorobenzene.
| Compound Name | 1-[chloro-(2,3,4-trifluorophenyl)methyl]-2,4,5-trifluorobenzene |
|---|---|
| PubChem CID | 103303785 |
| Molecular Formula | C13H5ClF6 |
| Molecular Weight | 310.62 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 1-[chloro-(2,3,4-trifluorophenyl)methyl]-2,4,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(C(Cl)c2ccc(F)c(F)c2F)cc1F |
| InChI | InChI=1S/C13H5ClF6/c14-11(5-1-2-7(15)13(20)12(5)19)6-3-9(17)10(18)4-8(6)16/h1-4,11H |
| InChIKey | RVFZWDRASSSQKX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|