C18H25ClO — CID 103165564
6-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 103165564) has the molecular formula C18H25ClO and a molecular weight of 292.85 g/mol. Its IUPAC name is 6-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 103165564 |
| Molecular Formula | C18H25ClO |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 6-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCOC1CC(CC(Cl)c2ccc3c(c2)CCCC3)C1 |
| InChI | InChI=1S/C18H25ClO/c1-2-20-17-9-13(10-17)11-18(19)16-8-7-14-5-3-4-6-15(14)12-16/h7-8,12-13,17-18H,2-6,9-11H2,1H3 |
| InChIKey | XPGDFVZOGBBLIQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|