C18H27BrO — CID 103166003
4-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-1,2-diethylbenzene (PubChem CID 103166003) has the molecular formula C18H27BrO and a molecular weight of 339.32 g/mol. Its IUPAC name is 4-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-1,2-diethylbenzene.
| Compound Name | 4-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-1,2-diethylbenzene |
|---|---|
| PubChem CID | 103166003 |
| Molecular Formula | C18H27BrO |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-1,2-diethylbenzene |
| SMILES | CCOC1CC(CC(Br)c2ccc(CC)c(CC)c2)C1 |
| InChI | InChI=1S/C18H27BrO/c1-4-14-7-8-16(12-15(14)5-2)18(19)11-13-9-17(10-13)20-6-3/h7-8,12-13,17-18H,4-6,9-11H2,1-3H3 |
| InChIKey | NEACGBUIATYQDX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|