C17H22BrNO2 — CID 103165907
7-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 103165907) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is 7-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 7-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 103165907 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 7-[1-bromo-2-(3-ethoxycyclobutyl)ethyl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | CCOC1CC(CC(Br)c2ccc3c(c2)C(=O)NCC3)C1 |
| InChI | InChI=1S/C17H22BrNO2/c1-2-21-14-7-11(8-14)9-16(18)13-4-3-12-5-6-19-17(20)15(12)10-13/h3-4,10-11,14,16H,2,5-9H2,1H3,(H,19,20) |
| InChIKey | KCWQTROAYKPFMP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|