C17H22BrNO — CID 106828577
7-[bromo-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 106828577) has the molecular formula C17H22BrNO and a molecular weight of 336.27 g/mol. Its IUPAC name is 7-[bromo-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 7-[bromo-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 106828577 |
| Molecular Formula | C17H22BrNO |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 7-[bromo-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | CC1(C(Br)c2ccc3c(c2)C(=O)NCC3)CCCCC1 |
| InChI | InChI=1S/C17H22BrNO/c1-17(8-3-2-4-9-17)15(18)13-6-5-12-7-10-19-16(20)14(12)11-13/h5-6,11,15H,2-4,7-10H2,1H3,(H,19,20) |
| InChIKey | MKZAXSCVHREBCV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|