C10H11F3N2O — CID 105215845
[1-(2,3-dihydro-1-benzofuran-5-yl)-2,2,2-trifluoroethyl]hydrazine (PubChem CID 105215845) has the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. Its IUPAC name is [1-(2,3-dihydro-1-benzofuran-5-yl)-2,2,2-trifluoroethyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1-benzofuran-5-yl)-2,2,2-trifluoroethyl]hydrazine |
|---|---|
| PubChem CID | 105215845 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | [1-(2,3-dihydro-1-benzofuran-5-yl)-2,2,2-trifluoroethyl]hydrazine |
| SMILES | NNC(c1ccc2c(c1)CCO2)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O/c11-10(12,13)9(15-14)7-1-2-8-6(5-7)3-4-16-8/h1-2,5,9,15H,3-4,14H2 |
| InChIKey | QORSLANGUAVOPI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|