C11H11F4NO — CID 79660691
1-(2,3-dihydro-1-benzofuran-5-yl)-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 79660691) has the molecular formula C11H11F4NO and a molecular weight of 249.21 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 79660691 |
| Molecular Formula | C11H11F4NO |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | NC(c1ccc2c(c1)CCO2)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H11F4NO/c12-10(13)11(14,15)9(16)7-1-2-8-6(5-7)3-4-17-8/h1-2,5,9-10H,3-4,16H2 |
| InChIKey | MAFBJJOCGXDKES-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|