About 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride
1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride (PubChem CID 159111103) has the molecular formula C24H36Cl2O
and a molecular weight of 411.46 g/mol. Its IUPAC name is 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride.
Molecular Properties
| Compound Name | 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride |
| PubChem CID | 159111103 |
| Molecular Formula | C24H36Cl2O |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride |
| SMILES | CC(C)Cc1ccc(C(C)Cl)cc1.CC(C)Cc1ccc(C(C)O)cc1.Cl |
| InChI | InChI=1S/C12H17Cl.C12H18O.ClH/c2*1-9(2)8-11-4-6-12(7-5-11)10(3)13;/h4-7,9-10H,8H2,1-3H3;4-7,9-10,13H,8H2,1-3H3;1H |
| InChIKey | UBBKOJCHJQFAAZ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride?
The IUPAC name of 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride (CID 159111103) is 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride.
What is the SMILES notation for 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride?
The canonical SMILES for 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride is CC(C)Cc1ccc(C(C)Cl)cc1.CC(C)Cc1ccc(C(C)O)cc1.Cl.
What is the InChIKey of 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride?
The InChIKey is UBBKOJCHJQFAAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Cl.C12H18O.ClH/c2*1-9(2)8-11-4-6-12(7-5-11)10(3)13;/h4-7,9-10H,8H2,1-3H3;4-7,9-10,13H,8H2,1-3H3;1H.
What are the key properties of 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride?
1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride has a molecular weight of 411.46 g/mol, XLogP of 7.55, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-chloroethyl)-4-(2-methylpropyl)benzene;1-[4-(2-methylpropyl)phenyl]ethanol;hydrochloride is sourced from PubChem (CID 159111103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).