C12H15Cl3O — CID 154190190
2,2,2-trichloro-1-[4-(2-methylpropyl)phenyl]ethanol (PubChem CID 154190190) has the molecular formula C12H15Cl3O and a molecular weight of 281.61 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[4-(2-methylpropyl)phenyl]ethanol.
| Compound Name | 2,2,2-trichloro-1-[4-(2-methylpropyl)phenyl]ethanol |
|---|---|
| PubChem CID | 154190190 |
| Molecular Formula | C12H15Cl3O |
| Molecular Weight | 281.61 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2,2,2-trichloro-1-[4-(2-methylpropyl)phenyl]ethanol |
| SMILES | CC(C)Cc1ccc(C(O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C12H15Cl3O/c1-8(2)7-9-3-5-10(6-4-9)11(16)12(13,14)15/h3-6,8,11,16H,7H2,1-2H3 |
| InChIKey | FVBSOBQMQOBCRU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|