C15H10Cl2OS2 — CID 104543726
5-chloro-7-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 104543726) has the molecular formula C15H10Cl2OS2 and a molecular weight of 341.28 g/mol. Its IUPAC name is 5-chloro-7-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-chloro-7-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104543726 |
| Molecular Formula | C15H10Cl2OS2 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 5-chloro-7-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Clc1cc2c(c(C(Cl)c3cc4sccc4s3)c1)OCC2 |
| InChI | InChI=1S/C15H10Cl2OS2/c16-9-5-8-1-3-18-15(8)10(6-9)14(17)13-7-12-11(20-13)2-4-19-12/h2,4-7,14H,1,3H2 |
| InChIKey | ZGJKDARXKPSTFB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|