C15H11Br2ClO — CID 113425206
5-bromo-7-[bromo-(3-chlorophenyl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 113425206) has the molecular formula C15H11Br2ClO and a molecular weight of 402.51 g/mol. Its IUPAC name is 5-bromo-7-[bromo-(3-chlorophenyl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-bromo-7-[bromo-(3-chlorophenyl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 113425206 |
| Molecular Formula | C15H11Br2ClO |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 399.89 |
| IUPAC Name | 5-bromo-7-[bromo-(3-chlorophenyl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Clc1cccc(C(Br)c2cc(Br)cc3c2OCC3)c1 |
| InChI | InChI=1S/C15H11Br2ClO/c16-11-6-10-4-5-19-15(10)13(8-11)14(17)9-2-1-3-12(18)7-9/h1-3,6-8,14H,4-5H2 |
| InChIKey | YFDSRTCWHVFTQA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|