C15H10BrCl3O — CID 104543305
5-bromo-7-[chloro-(2,6-dichlorophenyl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 104543305) has the molecular formula C15H10BrCl3O and a molecular weight of 392.51 g/mol. Its IUPAC name is 5-bromo-7-[chloro-(2,6-dichlorophenyl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-bromo-7-[chloro-(2,6-dichlorophenyl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104543305 |
| Molecular Formula | C15H10BrCl3O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 389.90 |
| IUPAC Name | 5-bromo-7-[chloro-(2,6-dichlorophenyl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Clc1cccc(Cl)c1C(Cl)c1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C15H10BrCl3O/c16-9-6-8-4-5-20-15(8)10(7-9)14(19)13-11(17)2-1-3-12(13)18/h1-3,6-7,14H,4-5H2 |
| InChIKey | GZJGPHWWHYMSSY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|