C10H7BrClF3O — CID 104543460
5-bromo-7-(1-chloro-2,2,2-trifluoroethyl)-2,3-dihydro-1-benzofuran (PubChem CID 104543460) has the molecular formula C10H7BrClF3O and a molecular weight of 315.52 g/mol. Its IUPAC name is 5-bromo-7-(1-chloro-2,2,2-trifluoroethyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 5-bromo-7-(1-chloro-2,2,2-trifluoroethyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104543460 |
| Molecular Formula | C10H7BrClF3O |
| Molecular Weight | 315.52 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | 5-bromo-7-(1-chloro-2,2,2-trifluoroethyl)-2,3-dihydro-1-benzofuran |
| SMILES | FC(F)(F)C(Cl)c1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C10H7BrClF3O/c11-6-3-5-1-2-16-8(5)7(4-6)9(12)10(13,14)15/h3-4,9H,1-2H2 |
| InChIKey | YXINVCZPWRJQEH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|