C14H16Br2O — CID 107002842
5-bromo-7-[bromo-(2,2-dimethylcyclopropyl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 107002842) has the molecular formula C14H16Br2O and a molecular weight of 360.09 g/mol. Its IUPAC name is 5-bromo-7-[bromo-(2,2-dimethylcyclopropyl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-bromo-7-[bromo-(2,2-dimethylcyclopropyl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 107002842 |
| Molecular Formula | C14H16Br2O |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 5-bromo-7-[bromo-(2,2-dimethylcyclopropyl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | CC1(C)CC1C(Br)c1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C14H16Br2O/c1-14(2)7-11(14)12(16)10-6-9(15)5-8-3-4-17-13(8)10/h5-6,11-12H,3-4,7H2,1-2H3 |
| InChIKey | PZHAIOJZZQDSTO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|