C11H16Br2N2 — CID 105293801
1-(2,5-dibromophenyl)pentylhydrazine (PubChem CID 105293801) has the molecular formula C11H16Br2N2 and a molecular weight of 336.07 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)pentylhydrazine.
| Compound Name | 1-(2,5-dibromophenyl)pentylhydrazine |
|---|---|
| PubChem CID | 105293801 |
| Molecular Formula | C11H16Br2N2 |
| Molecular Weight | 336.07 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | 1-(2,5-dibromophenyl)pentylhydrazine |
| SMILES | CCCCC(NN)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H16Br2N2/c1-2-3-4-11(15-14)9-7-8(12)5-6-10(9)13/h5-7,11,15H,2-4,14H2,1H3 |
| InChIKey | FUSRRFKCIKPSBG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.07 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|