C12H14Br2N2 — CID 105333449
1-(2,5-dibromophenyl)hex-5-ynylhydrazine (PubChem CID 105333449) has the molecular formula C12H14Br2N2 and a molecular weight of 346.07 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)hex-5-ynylhydrazine.
| Compound Name | 1-(2,5-dibromophenyl)hex-5-ynylhydrazine |
|---|---|
| PubChem CID | 105333449 |
| Molecular Formula | C12H14Br2N2 |
| Molecular Weight | 346.07 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 1-(2,5-dibromophenyl)hex-5-ynylhydrazine |
| SMILES | C#CCCCC(NN)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H14Br2N2/c1-2-3-4-5-12(16-15)10-8-9(13)6-7-11(10)14/h1,6-8,12,16H,3-5,15H2 |
| InChIKey | GQSXZGFXNHLLNR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.07 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|