C12H13Br2N — CID 115859658
1-(2,5-dibromophenyl)-N-methylpent-4-yn-1-amine (PubChem CID 115859658) has the molecular formula C12H13Br2N and a molecular weight of 331.05 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-N-methylpent-4-yn-1-amine.
| Compound Name | 1-(2,5-dibromophenyl)-N-methylpent-4-yn-1-amine |
|---|---|
| PubChem CID | 115859658 |
| Molecular Formula | C12H13Br2N |
| Molecular Weight | 331.05 g/mol |
| Exact Mass | 328.94 |
| IUPAC Name | 1-(2,5-dibromophenyl)-N-methylpent-4-yn-1-amine |
| SMILES | C#CCCC(NC)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H13Br2N/c1-3-4-5-12(15-2)10-8-9(13)6-7-11(10)14/h1,6-8,12,15H,4-5H2,2H3 |
| InChIKey | BMNLXQVOBUSWET-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.05 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|