C9H11Br2NO — CID 131062673
(2R)-2-(2,5-dibromophenyl)-2-(methylamino)ethanol (PubChem CID 131062673) has the molecular formula C9H11Br2NO and a molecular weight of 309.00 g/mol. Its IUPAC name is (2R)-2-(2,5-dibromophenyl)-2-(methylamino)ethanol.
| Compound Name | (2R)-2-(2,5-dibromophenyl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 131062673 |
| Molecular Formula | C9H11Br2NO |
| Molecular Weight | 309.00 g/mol |
| Exact Mass | 306.92 |
| IUPAC Name | (2R)-2-(2,5-dibromophenyl)-2-(methylamino)ethanol |
| SMILES | CN[C@@H](CO)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C9H11Br2NO/c1-12-9(5-13)7-4-6(10)2-3-8(7)11/h2-4,9,12-13H,5H2,1H3/t9-/m0/s1 |
| InChIKey | SUOISUHHIXKLFA-VIFPVBQESA-N |
| XLogP | 2.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.00 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |