C13H13BrF3N — CID 115859577
1-[4-bromo-3-(trifluoromethyl)phenyl]-N-methylpent-4-yn-1-amine (PubChem CID 115859577) has the molecular formula C13H13BrF3N and a molecular weight of 320.15 g/mol. Its IUPAC name is 1-[4-bromo-3-(trifluoromethyl)phenyl]-N-methylpent-4-yn-1-amine.
| Compound Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-N-methylpent-4-yn-1-amine |
|---|---|
| PubChem CID | 115859577 |
| Molecular Formula | C13H13BrF3N |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-N-methylpent-4-yn-1-amine |
| SMILES | C#CCCC(NC)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13BrF3N/c1-3-4-5-12(18-2)9-6-7-11(14)10(8-9)13(15,16)17/h1,6-8,12,18H,4-5H2,2H3 |
| InChIKey | ZNQDXPMEEOZMTE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|