C19H32BrN — CID 115806096
1-(2-bromo-5-methylphenyl)-3-ethyl-N-propylheptan-1-amine (PubChem CID 115806096) has the molecular formula C19H32BrN and a molecular weight of 354.38 g/mol. Its IUPAC name is 1-(2-bromo-5-methylphenyl)-3-ethyl-N-propylheptan-1-amine.
| Compound Name | 1-(2-bromo-5-methylphenyl)-3-ethyl-N-propylheptan-1-amine |
|---|---|
| PubChem CID | 115806096 |
| Molecular Formula | C19H32BrN |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-(2-bromo-5-methylphenyl)-3-ethyl-N-propylheptan-1-amine |
| SMILES | CCCCC(CC)CC(NCCC)c1cc(C)ccc1Br |
| InChI | InChI=1S/C19H32BrN/c1-5-8-9-16(7-3)14-19(21-12-6-2)17-13-15(4)10-11-18(17)20/h10-11,13,16,19,21H,5-9,12,14H2,1-4H3 |
| InChIKey | XEAVWVVGRQHBCU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |