C13H23NO — CID 82922422
N,3-diethyl-1-(furan-2-yl)pentan-1-amine (PubChem CID 82922422) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is N,3-diethyl-1-(furan-2-yl)pentan-1-amine.
| Compound Name | N,3-diethyl-1-(furan-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 82922422 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N,3-diethyl-1-(furan-2-yl)pentan-1-amine |
| SMILES | CCNC(CC(CC)CC)c1ccco1 |
| InChI | InChI=1S/C13H23NO/c1-4-11(5-2)10-12(14-6-3)13-8-7-9-15-13/h7-9,11-12,14H,4-6,10H2,1-3H3 |
| InChIKey | UTVGKUGTZGPOIS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |