C9H16N2O — CID 62633441
N'-[1-(furan-2-yl)propyl]ethane-1,2-diamine (PubChem CID 62633441) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N'-[1-(furan-2-yl)propyl]ethane-1,2-diamine.
| Compound Name | N'-[1-(furan-2-yl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62633441 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N'-[1-(furan-2-yl)propyl]ethane-1,2-diamine |
| SMILES | CCC(NCCN)c1ccco1 |
| InChI | InChI=1S/C9H16N2O/c1-2-8(11-6-5-10)9-4-3-7-12-9/h3-4,7-8,11H,2,5-6,10H2,1H3 |
| InChIKey | UPTYRIPBXNMSSO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |