C11H20N2O — CID 62633443
N'-[1-(furan-2-yl)propyl]butane-1,4-diamine (PubChem CID 62633443) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N'-[1-(furan-2-yl)propyl]butane-1,4-diamine.
| Compound Name | N'-[1-(furan-2-yl)propyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 62633443 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N'-[1-(furan-2-yl)propyl]butane-1,4-diamine |
| SMILES | CCC(NCCCCN)c1ccco1 |
| InChI | InChI=1S/C11H20N2O/c1-2-10(11-6-5-9-14-11)13-8-4-3-7-12/h5-6,9-10,13H,2-4,7-8,12H2,1H3 |
| InChIKey | OWLOOASJGATDLN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|