C14H23NO — CID 62633625
N-(2-cyclopentylethyl)-1-(furan-2-yl)propan-1-amine (PubChem CID 62633625) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N-(2-cyclopentylethyl)-1-(furan-2-yl)propan-1-amine.
| Compound Name | N-(2-cyclopentylethyl)-1-(furan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 62633625 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-(2-cyclopentylethyl)-1-(furan-2-yl)propan-1-amine |
| SMILES | CCC(NCCC1CCCC1)c1ccco1 |
| InChI | InChI=1S/C14H23NO/c1-2-13(14-8-5-11-16-14)15-10-9-12-6-3-4-7-12/h5,8,11-13,15H,2-4,6-7,9-10H2,1H3 |
| InChIKey | FTDQLNQJTFKQGY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |