C15H25NO3 — CID 62632149
1-(furan-2-yl)-N-[3-(oxolan-2-ylmethoxy)propyl]propan-1-amine (PubChem CID 62632149) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-(furan-2-yl)-N-[3-(oxolan-2-ylmethoxy)propyl]propan-1-amine.
| Compound Name | 1-(furan-2-yl)-N-[3-(oxolan-2-ylmethoxy)propyl]propan-1-amine |
|---|---|
| PubChem CID | 62632149 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-(furan-2-yl)-N-[3-(oxolan-2-ylmethoxy)propyl]propan-1-amine |
| SMILES | CCC(NCCCOCC1CCCO1)c1ccco1 |
| InChI | InChI=1S/C15H25NO3/c1-2-14(15-7-4-11-19-15)16-8-5-9-17-12-13-6-3-10-18-13/h4,7,11,13-14,16H,2-3,5-6,8-10,12H2,1H3 |
| InChIKey | YWJZKDXAKUZCLW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|