C15H24BrN — CID 105017274
1-(5-bromo-2-methylphenyl)-2-methyl-N-propylbutan-1-amine (PubChem CID 105017274) has the molecular formula C15H24BrN and a molecular weight of 298.27 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-2-methyl-N-propylbutan-1-amine.
| Compound Name | 1-(5-bromo-2-methylphenyl)-2-methyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 105017274 |
| Molecular Formula | C15H24BrN |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-2-methyl-N-propylbutan-1-amine |
| SMILES | CCCNC(c1cc(Br)ccc1C)C(C)CC |
| InChI | InChI=1S/C15H24BrN/c1-5-9-17-15(11(3)6-2)14-10-13(16)8-7-12(14)4/h7-8,10-11,15,17H,5-6,9H2,1-4H3 |
| InChIKey | GAKKSLMQUFXJNG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |