C15H16BrCl — CID 79597822
1-(1-bromo-2,2-dimethylpropyl)-4-chloronaphthalene (PubChem CID 79597822) has the molecular formula C15H16BrCl and a molecular weight of 311.65 g/mol. Its IUPAC name is 1-(1-bromo-2,2-dimethylpropyl)-4-chloronaphthalene.
| Compound Name | 1-(1-bromo-2,2-dimethylpropyl)-4-chloronaphthalene |
|---|---|
| PubChem CID | 79597822 |
| Molecular Formula | C15H16BrCl |
| Molecular Weight | 311.65 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 1-(1-bromo-2,2-dimethylpropyl)-4-chloronaphthalene |
| SMILES | CC(C)(C)C(Br)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C15H16BrCl/c1-15(2,3)14(16)12-8-9-13(17)11-7-5-4-6-10(11)12/h4-9,14H,1-3H3 |
| InChIKey | HPPHFZMXECQYRD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.65 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|