C14H21ClN2O3S — CID 56793619
N-[1-(4-chlorophenyl)propan-2-yl]-N-methyl-2-[methyl(methylsulfonyl)amino]acetamide (PubChem CID 56793619) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)propan-2-yl]-N-methyl-2-[methyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-[1-(4-chlorophenyl)propan-2-yl]-N-methyl-2-[methyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 56793619 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)propan-2-yl]-N-methyl-2-[methyl(methylsulfonyl)amino]acetamide |
| SMILES | CC(Cc1ccc(Cl)cc1)N(C)C(=O)CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C14H21ClN2O3S/c1-11(9-12-5-7-13(15)8-6-12)17(3)14(18)10-16(2)21(4,19)20/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | WRBFUEXTJSLROR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |