C23H25N3 — CID 154448669
1-(1,2-dihydroacenaphthylen-5-yl)-2-methyl-1-(2-phenylpropyl)guanidine (PubChem CID 154448669) has the molecular formula C23H25N3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-5-yl)-2-methyl-1-(2-phenylpropyl)guanidine.
| Compound Name | 1-(1,2-dihydroacenaphthylen-5-yl)-2-methyl-1-(2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 154448669 |
| Molecular Formula | C23H25N3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-5-yl)-2-methyl-1-(2-phenylpropyl)guanidine |
| SMILES | C/N=C(\N)N(CC(C)c1ccccc1)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C23H25N3/c1-16(17-7-4-3-5-8-17)15-26(23(24)25-2)21-14-13-19-12-11-18-9-6-10-20(21)22(18)19/h3-10,13-14,16H,11-12,15H2,1-2H3,(H2,24,25) |
| InChIKey | MGKZWSDRSKDOMX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|