C22H23N3O — CID 22675730
1-(1,2-dihydroacenaphthylen-5-yl)-2-(1-phenoxypropan-2-yl)guanidine (PubChem CID 22675730) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-5-yl)-2-(1-phenoxypropan-2-yl)guanidine.
| Compound Name | 1-(1,2-dihydroacenaphthylen-5-yl)-2-(1-phenoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 22675730 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-5-yl)-2-(1-phenoxypropan-2-yl)guanidine |
| SMILES | CC(COc1ccccc1)/N=C(\N)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C22H23N3O/c1-15(14-26-18-7-3-2-4-8-18)24-22(23)25-20-13-12-17-11-10-16-6-5-9-19(20)21(16)17/h2-9,12-13,15H,10-11,14H2,1H3,(H3,23,24,25) |
| InChIKey | ZLWCKRLSSGRSFB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|