C23H20N4 — CID 18751648
2-(2-aminonaphthalen-1-yl)-1-(1,2-dihydroacenaphthylen-5-yl)guanidine (PubChem CID 18751648) has the molecular formula C23H20N4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-(2-aminonaphthalen-1-yl)-1-(1,2-dihydroacenaphthylen-5-yl)guanidine.
| Compound Name | 2-(2-aminonaphthalen-1-yl)-1-(1,2-dihydroacenaphthylen-5-yl)guanidine |
|---|---|
| PubChem CID | 18751648 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-(2-aminonaphthalen-1-yl)-1-(1,2-dihydroacenaphthylen-5-yl)guanidine |
| SMILES | N/C(=N\c1c(N)ccc2ccccc12)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C23H20N4/c24-19-12-10-14-4-1-2-6-17(14)22(19)27-23(25)26-20-13-11-16-9-8-15-5-3-7-18(20)21(15)16/h1-7,10-13H,8-9,24H2,(H3,25,26,27) |
| InChIKey | NQOJFIZZAQRMAC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|