C12H12BrN — CID 158935493
1,2-dihydroacenaphthylen-3-amine;hydrobromide (PubChem CID 158935493) has the molecular formula C12H12BrN and a molecular weight of 250.14 g/mol. Its IUPAC name is 1,2-dihydroacenaphthylen-3-amine;hydrobromide.
| Compound Name | 1,2-dihydroacenaphthylen-3-amine;hydrobromide |
|---|---|
| PubChem CID | 158935493 |
| Molecular Formula | C12H12BrN |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 1,2-dihydroacenaphthylen-3-amine;hydrobromide |
| SMILES | Br.Nc1ccc2cccc3c2c1CC3 |
| InChI | InChI=1S/C12H11N.BrH/c13-11-7-5-9-3-1-2-8-4-6-10(11)12(8)9;/h1-3,5,7H,4,6,13H2;1H |
| InChIKey | JJPAZDVKZVOIDY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|