C32H22 — CID 157201241
1,2-dihydroacenaphthylene;perylene (PubChem CID 157201241) has the molecular formula C32H22 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1,2-dihydroacenaphthylene;perylene.
| Compound Name | 1,2-dihydroacenaphthylene;perylene |
|---|---|
| PubChem CID | 157201241 |
| Molecular Formula | C32H22 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1,2-dihydroacenaphthylene;perylene |
| SMILES | c1cc2c3c(cccc3c1)CC2.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C12H10/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-12H;1-6H,7-8H2 |
| InChIKey | AQVCGDIAMLNXNK-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|