About 1,2-dihydroacenaphthylene;dioxotitanium
1,2-dihydroacenaphthylene;dioxotitanium (PubChem CID 175288385) has the molecular formula C12H10O2Ti
and a molecular weight of 234.08 g/mol. Its IUPAC name is 1,2-dihydroacenaphthylene;dioxotitanium.
Molecular Properties
| Compound Name | 1,2-dihydroacenaphthylene;dioxotitanium |
| PubChem CID | 175288385 |
| Molecular Formula | C12H10O2Ti |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 1,2-dihydroacenaphthylene;dioxotitanium |
| SMILES | O=[Ti]=O.c1cc2c3c(cccc3c1)CC2 |
| InChI | InChI=1S/C12H10.2O.Ti/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;;;/h1-6H,7-8H2;;; |
| InChIKey | YCCIKIPBWJPDEE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dihydroacenaphthylene;dioxotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroacenaphthylene;dioxotitanium?
The IUPAC name of 1,2-dihydroacenaphthylene;dioxotitanium (CID 175288385) is 1,2-dihydroacenaphthylene;dioxotitanium.
What is the SMILES notation for 1,2-dihydroacenaphthylene;dioxotitanium?
The canonical SMILES for 1,2-dihydroacenaphthylene;dioxotitanium is O=[Ti]=O.c1cc2c3c(cccc3c1)CC2.
What is the InChIKey of 1,2-dihydroacenaphthylene;dioxotitanium?
The InChIKey is YCCIKIPBWJPDEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.2O.Ti/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;;;/h1-6H,7-8H2;;;.
What are the key properties of 1,2-dihydroacenaphthylene;dioxotitanium?
1,2-dihydroacenaphthylene;dioxotitanium has a molecular weight of 234.08 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroacenaphthylene;dioxotitanium is sourced from PubChem (CID 175288385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).