C12H10O2Ti — CID 175288385
1,2-dihydroacenaphthylene;dioxotitanium (PubChem CID 175288385) has the molecular formula C12H10O2Ti and a molecular weight of 234.08 g/mol. Its IUPAC name is 1,2-dihydroacenaphthylene;dioxotitanium.
| Compound Name | 1,2-dihydroacenaphthylene;dioxotitanium |
|---|---|
| PubChem CID | 175288385 |
| Molecular Formula | C12H10O2Ti |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 1,2-dihydroacenaphthylene;dioxotitanium |
| SMILES | O=[Ti]=O.c1cc2c3c(cccc3c1)CC2 |
| InChI | InChI=1S/C12H10.2O.Ti/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;;;/h1-6H,7-8H2;;; |
| InChIKey | YCCIKIPBWJPDEE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |