C12H9ClO2S — CID 121008066
1,2-dihydroacenaphthylene-3-sulfonyl chloride (PubChem CID 121008066) has the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. Its IUPAC name is 1,2-dihydroacenaphthylene-3-sulfonyl chloride.
| Compound Name | 1,2-dihydroacenaphthylene-3-sulfonyl chloride |
|---|---|
| PubChem CID | 121008066 |
| Molecular Formula | C12H9ClO2S |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 1,2-dihydroacenaphthylene-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc2cccc3c2c1CC3 |
| InChI | InChI=1S/C12H9ClO2S/c13-16(14,15)11-7-5-9-3-1-2-8-4-6-10(11)12(8)9/h1-3,5,7H,4,6H2 |
| InChIKey | UMQWXUXRGLGYAF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |