C19H14N2O2S — CID 8834385
N-(2-cyanophenyl)-1,2-dihydroacenaphthylene-3-sulfonamide (PubChem CID 8834385) has the molecular formula C19H14N2O2S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(2-cyanophenyl)-1,2-dihydroacenaphthylene-3-sulfonamide.
| Compound Name | N-(2-cyanophenyl)-1,2-dihydroacenaphthylene-3-sulfonamide |
|---|---|
| PubChem CID | 8834385 |
| Molecular Formula | C19H14N2O2S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-(2-cyanophenyl)-1,2-dihydroacenaphthylene-3-sulfonamide |
| SMILES | N#Cc1ccccc1NS(=O)(=O)c1ccc2cccc3c2c1CC3 |
| InChI | InChI=1S/C19H14N2O2S/c20-12-15-4-1-2-7-17(15)21-24(22,23)18-11-9-14-6-3-5-13-8-10-16(18)19(13)14/h1-7,9,11,21H,8,10H2 |
| InChIKey | HWBVWQQVWJOQAN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |