C12H9KO3S — CID 146050724
potassium 1,2-dihydroacenaphthylene-3-sulfonate (PubChem CID 146050724) has the molecular formula C12H9KO3S and a molecular weight of 272.37 g/mol. Its IUPAC name is potassium 1,2-dihydroacenaphthylene-3-sulfonate.
| Compound Name | potassium 1,2-dihydroacenaphthylene-3-sulfonate |
|---|---|
| PubChem CID | 146050724 |
| Molecular Formula | C12H9KO3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | potassium 1,2-dihydroacenaphthylene-3-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2cccc3c2c1CC3.[K+] |
| InChI | InChI=1S/C12H10O3S.K/c13-16(14,15)11-7-5-9-3-1-2-8-4-6-10(11)12(8)9;/h1-3,5,7H,4,6H2,(H,13,14,15);/q;+1/p-1 |
| InChIKey | ASVGOWKBLNAPFD-UHFFFAOYSA-M |
| XLogP | -1.15 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|