C13H13B — CID 177264468
3-methyl-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 177264468) has the molecular formula C13H13B and a molecular weight of 180.06 g/mol. Its IUPAC name is 3-methyl-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 3-methyl-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 177264468 |
| Molecular Formula | C13H13B |
| Molecular Weight | 180.06 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 3-methyl-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | CB1Cc2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C13H13B/c1-14-8-11-6-2-4-10-5-3-7-12(9-14)13(10)11/h2-7H,8-9H2,1H3 |
| InChIKey | YEOHDDPGVFJNGZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.06 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|