C13H10Cl2 — CID 174423090
2,2-dichloro-1,3-dihydrophenalene (PubChem CID 174423090) has the molecular formula C13H10Cl2 and a molecular weight of 237.13 g/mol. Its IUPAC name is 2,2-dichloro-1,3-dihydrophenalene.
| Compound Name | 2,2-dichloro-1,3-dihydrophenalene |
|---|---|
| PubChem CID | 174423090 |
| Molecular Formula | C13H10Cl2 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 2,2-dichloro-1,3-dihydrophenalene |
| SMILES | ClC1(Cl)Cc2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C13H10Cl2/c14-13(15)7-10-5-1-3-9-4-2-6-11(8-13)12(9)10/h1-6H,7-8H2 |
| InChIKey | VXDFYCCPIQYOTG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|