About 2,2-dichloro-1,3-dihydrophenalene
2,2-dichloro-1,3-dihydrophenalene (PubChem CID 174423090) has the molecular formula C13H10Cl2
and a molecular weight of 237.13 g/mol. Its IUPAC name is 2,2-dichloro-1,3-dihydrophenalene.
Molecular Properties
| Compound Name | 2,2-dichloro-1,3-dihydrophenalene |
| PubChem CID | 174423090 |
| Molecular Formula | C13H10Cl2 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 2,2-dichloro-1,3-dihydrophenalene |
| SMILES | ClC1(Cl)Cc2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C13H10Cl2/c14-13(15)7-10-5-1-3-9-4-2-6-11(8-13)12(9)10/h1-6H,7-8H2 |
| InChIKey | VXDFYCCPIQYOTG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-1,3-dihydrophenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-1,3-dihydrophenalene?
The IUPAC name of 2,2-dichloro-1,3-dihydrophenalene (CID 174423090) is 2,2-dichloro-1,3-dihydrophenalene.
What is the SMILES notation for 2,2-dichloro-1,3-dihydrophenalene?
The canonical SMILES for 2,2-dichloro-1,3-dihydrophenalene is ClC1(Cl)Cc2cccc3cccc(c23)C1.
What is the InChIKey of 2,2-dichloro-1,3-dihydrophenalene?
The InChIKey is VXDFYCCPIQYOTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2/c14-13(15)7-10-5-1-3-9-4-2-6-11(8-13)12(9)10/h1-6H,7-8H2.
What are the key properties of 2,2-dichloro-1,3-dihydrophenalene?
2,2-dichloro-1,3-dihydrophenalene has a molecular weight of 237.13 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-1,3-dihydrophenalene is sourced from PubChem (CID 174423090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).