C14H14S2 — CID 603823
12-methyl-11,13-dithiatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene (PubChem CID 603823) has the molecular formula C14H14S2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 12-methyl-11,13-dithiatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene.
| Compound Name | 12-methyl-11,13-dithiatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene |
|---|---|
| PubChem CID | 603823 |
| Molecular Formula | C14H14S2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 12-methyl-11,13-dithiatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene |
| SMILES | CC1SCc2cccc3cccc(c23)CS1 |
| InChI | InChI=1S/C14H14S2/c1-10-15-8-12-6-2-4-11-5-3-7-13(9-16-10)14(11)12/h2-7,10H,8-9H2,1H3 |
| InChIKey | HIKIVDWONDOWPT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |