C13H13O4P — CID 101178463
12-methoxy-12-oxido-11,13-dioxa-12-phosphoniatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene (PubChem CID 101178463) has the molecular formula C13H13O4P and a molecular weight of 264.22 g/mol. Its IUPAC name is 12-methoxy-12-oxido-11,13-dioxa-12-phosphoniatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene.
| Compound Name | 12-methoxy-12-oxido-11,13-dioxa-12-phosphoniatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene |
|---|---|
| PubChem CID | 101178463 |
| Molecular Formula | C13H13O4P |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 12-methoxy-12-oxido-11,13-dioxa-12-phosphoniatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene |
| SMILES | CO[P+]1([O-])OCc2cccc3cccc(c23)CO1 |
| InChI | InChI=1S/C13H13O4P/c1-15-18(14)16-8-11-6-2-4-10-5-3-7-12(9-17-18)13(10)11/h2-7H,8-9H2,1H3 |
| InChIKey | QLPKBCBBPXNQHR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|