C12H10O2 — CID 129383948
(1S)-1-hydroperoxy-1,2-dihydroacenaphthylene (PubChem CID 129383948) has the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene.
| Compound Name | (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 129383948 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene |
| SMILES | OO[C@H]1Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C12H10O2/c13-14-11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1-6,11,13H,7H2/t11-/m0/s1 |
| InChIKey | TYZJFSFOAXWMJH-NSHDSACASA-N |
| XLogP | 2.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|