About (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene
(1S)-1-hydroperoxy-1,2-dihydroacenaphthylene (PubChem CID 129383948) has the molecular formula C12H10O2
and a molecular weight of 186.21 g/mol. Its IUPAC name is (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene.
Molecular Properties
| Compound Name | (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene |
| PubChem CID | 129383948 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene |
| SMILES | OO[C@H]1Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C12H10O2/c13-14-11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1-6,11,13H,7H2/t11-/m0/s1 |
| InChIKey | TYZJFSFOAXWMJH-NSHDSACASA-N |
| XLogP | 2.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene?
The IUPAC name of (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene (CID 129383948) is (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene.
What is the SMILES notation for (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene?
The canonical SMILES for (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene is OO[C@H]1Cc2cccc3cccc1c23.
What is the InChIKey of (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene?
The InChIKey is TYZJFSFOAXWMJH-NSHDSACASA-N. The full InChI is InChI=1S/C12H10O2/c13-14-11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1-6,11,13H,7H2/t11-/m0/s1.
What are the key properties of (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene?
(1S)-1-hydroperoxy-1,2-dihydroacenaphthylene has a molecular weight of 186.21 g/mol, XLogP of 2.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-hydroperoxy-1,2-dihydroacenaphthylene is sourced from PubChem (CID 129383948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).