C20H28NO+ — CID 4245314
2-(1,2-dihydroacenaphthylen-1-yloxy)ethyl-triethylazanium (PubChem CID 4245314) has the molecular formula C20H28NO+ and a molecular weight of 298.45 g/mol. Its IUPAC name is 2-(1,2-dihydroacenaphthylen-1-yloxy)ethyl-triethylazanium.
| Compound Name | 2-(1,2-dihydroacenaphthylen-1-yloxy)ethyl-triethylazanium |
|---|---|
| PubChem CID | 4245314 |
| Molecular Formula | C20H28NO+ |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 2-(1,2-dihydroacenaphthylen-1-yloxy)ethyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCOC1Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C20H28NO/c1-4-21(5-2,6-3)13-14-22-19-15-17-11-7-9-16-10-8-12-18(19)20(16)17/h7-12,19H,4-6,13-15H2,1-3H3/q+1 |
| InChIKey | XHUAMMWOJVLFAA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|