C13H13N — CID 92976167
[(1R)-1,2-dihydroacenaphthylen-1-yl]methanamine (PubChem CID 92976167) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is [(1R)-1,2-dihydroacenaphthylen-1-yl]methanamine.
| Compound Name | [(1R)-1,2-dihydroacenaphthylen-1-yl]methanamine |
|---|---|
| PubChem CID | 92976167 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | [(1R)-1,2-dihydroacenaphthylen-1-yl]methanamine |
| SMILES | NC[C@@H]1Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C13H13N/c14-8-11-7-10-5-1-3-9-4-2-6-12(11)13(9)10/h1-6,11H,7-8,14H2/t11-/m0/s1 |
| InChIKey | NWYAZKKOCBVCIC-NSHDSACASA-N |
| XLogP | 2.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |