C20H19I — CID 12847577
4-(4-iodobutyl)-4,5-dihydropyrene (PubChem CID 12847577) has the molecular formula C20H19I and a molecular weight of 386.28 g/mol. Its IUPAC name is 4-(4-iodobutyl)-4,5-dihydropyrene.
| Compound Name | 4-(4-iodobutyl)-4,5-dihydropyrene |
|---|---|
| PubChem CID | 12847577 |
| Molecular Formula | C20H19I |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 4-(4-iodobutyl)-4,5-dihydropyrene |
| SMILES | ICCCCC1Cc2cccc3ccc4cccc1c4c23 |
| InChI | InChI=1S/C20H19I/c21-12-2-1-5-16-13-17-8-3-6-14-10-11-15-7-4-9-18(16)20(15)19(14)17/h3-4,6-11,16H,1-2,5,12-13H2 |
| InChIKey | PTUWOVBLZPKGMJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|