C15H15+ — CID 146033419
2,2-dimethyl-1,3-dihydrophenalen-3-ylium (PubChem CID 146033419) has the molecular formula C15H15+ and a molecular weight of 195.29 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dihydrophenalen-3-ylium.
| Compound Name | 2,2-dimethyl-1,3-dihydrophenalen-3-ylium |
|---|---|
| PubChem CID | 146033419 |
| Molecular Formula | C15H15+ |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 2,2-dimethyl-1,3-dihydrophenalen-3-ylium |
| SMILES | CC1(C)[CH+]c2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C15H15/c1-15(2)9-12-7-3-5-11-6-4-8-13(10-15)14(11)12/h3-9H,10H2,1-2H3/q+1 |
| InChIKey | JJOAWQGMUSOLRD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|