C17H19N — CID 134385979
11,11-dimethyl-13-methylidene-10-azatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene (PubChem CID 134385979) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 11,11-dimethyl-13-methylidene-10-azatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene.
| Compound Name | 11,11-dimethyl-13-methylidene-10-azatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene |
|---|---|
| PubChem CID | 134385979 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 11,11-dimethyl-13-methylidene-10-azatricyclo[7.5.1.05,15]pentadeca-1,3,5(15),6,8-pentaene |
| SMILES | C=C1Cc2cccc3cccc(c23)NC(C)(C)C1 |
| InChI | InChI=1S/C17H19N/c1-12-10-14-8-4-6-13-7-5-9-15(16(13)14)18-17(2,3)11-12/h4-9,18H,1,10-11H2,2-3H3 |
| InChIKey | XDNVJUSFKZRMBA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|