C13H12N2 — CID 20710448
12-methyl-10,13-diazatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 20710448) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 12-methyl-10,13-diazatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | 12-methyl-10,13-diazatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 20710448 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 12-methyl-10,13-diazatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | CC12CN1c1cccc3cccc(c13)N2 |
| InChI | InChI=1S/C13H12N2/c1-13-8-15(13)11-7-3-5-9-4-2-6-10(14-13)12(9)11/h2-7,14H,8H2,1H3 |
| InChIKey | IHCYYXJPQCAOBV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|